3-(3-Bromo-4,5-dimethoxyphenyl)acrylic acid
Modify Date: 2025-09-19 12:32:58
3-(3-Bromo-4,5-dimethoxyphenyl)acrylic acid structure
|
Common Name | 3-(3-Bromo-4,5-dimethoxyphenyl)acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 51314-72-8 | Molecular Weight | 287.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-Bromo-4,5-dimethoxyphenyl)acrylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11BrO4 |
|---|---|
| Molecular Weight | 287.10700 |
| Exact Mass | 285.98400 |
| PSA | 55.76000 |
| LogP | 2.56410 |
| InChIKey | XPEVBCFMEHTNHN-ONEGZZNKSA-N |
| SMILES | COc1cc(C=CC(=O)O)cc(Br)c1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Bromo-3,6-dimethyluracil |
| 2-bromo-3,4-dimethoxycinnamic acid |
| 5-Brom-3,6-dimethyl-1H-pyrimidin-2,4-dion |
| 5-Brom-3.4-dimethoxy-zimtsaeure |