Benzoic acid,benzoyl(1,1-dimethylethyl)azanyl ester structure
|
Common Name | Benzoic acid,benzoyl(1,1-dimethylethyl)azanyl ester | ||
|---|---|---|---|---|
| CAS Number | 51339-08-3 | Molecular Weight | 297.34800 | |
| Density | 1.143g/cm3 | Boiling Point | 398.6ºC at 760mmHg | |
| Molecular Formula | C18H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.8ºC | |
| Name | [benzoyl(tert-butyl)amino] benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 398.6ºC at 760mmHg |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.34800 |
| Flash Point | 194.8ºC |
| Exact Mass | 297.13600 |
| PSA | 46.61000 |
| LogP | 3.69930 |
| Index of Refraction | 1.569 |
| InChIKey | PLXHVQVLZHOFDY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N(OC(=O)c1ccccc1)C(=O)c1ccccc1 |
|
~69%
Benzoic acid,be... CAS#:51339-08-3 |
| Literature: Uchida, Yuzuru; Hashimoto, Yukinobu; Kozuka, Seizi Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 8 p. 2309 - 2314 |
|
~%
Benzoic acid,be... CAS#:51339-08-3
Detail
|
| Literature: Smith, John; Tedder, John M. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1987 , p. 895 - 896 |
| N-benzoyl-O-benzoyl-N-t-butylhydroxylamine |
| N-tert.-Butyl-N,O-dibenzoyl-hydroxylamin |