N-Isopropyl-α-methyl-3-(trifluoromethyl)benzeneethanamine structure
|
Common Name | N-Isopropyl-α-methyl-3-(trifluoromethyl)benzeneethanamine | ||
|---|---|---|---|---|
| CAS Number | 51353-04-9 | Molecular Weight | 245.28400 | |
| Density | 1.06g/cm3 | Boiling Point | 257ºC at 760 mmHg | |
| Molecular Formula | C13H18F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.2ºC | |
| Name | N-propan-2-yl-1-[3-(trifluoromethyl)phenyl]propan-2-amine |
|---|
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 257ºC at 760 mmHg |
| Molecular Formula | C13H18F3N |
| Molecular Weight | 245.28400 |
| Flash Point | 109.2ºC |
| Exact Mass | 245.13900 |
| PSA | 12.03000 |
| LogP | 4.02530 |
| Index of Refraction | 1.455 |
| InChIKey | NFNFGNLAOQRPPO-UHFFFAOYSA-N |
| SMILES | CC(C)NC(C)Cc1cccc(C(F)(F)F)c1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |