ethyl 2,7,7-trimethyl-5-oxo-4-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxylate structure
|
Common Name | ethyl 2,7,7-trimethyl-5-oxo-4-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5136-15-2 | Molecular Weight | 340.41600 | |
| Density | 1.19g/cm3 | Boiling Point | 496.5ºC at 760 mmHg | |
| Molecular Formula | C20H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.1ºC | |
| Name | ethyl 2,7,7-trimethyl-5-oxo-4-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 496.5ºC at 760 mmHg |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.41600 |
| Flash Point | 254.1ºC |
| Exact Mass | 340.17900 |
| PSA | 68.29000 |
| LogP | 3.57750 |
| Index of Refraction | 1.575 |
| InChIKey | UISSLKINORBWCP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)CC(C)(C)C2)C1c1cccnc1 |
|
~%
ethyl 2,7,7-tri... CAS#:5136-15-2 |
| Literature: Whitehead,C.W. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 2814 - 2818 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |