Anisatin
Anisatin structure
|
Common Name | Anisatin | ||
|---|---|---|---|---|
| CAS Number | 51372-90-8 | Molecular Weight | 328.31500 | |
| Density | 1.63g/cm3 | Boiling Point | 609.5ºC at 760 mmHg | |
| Molecular Formula | C15H20O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Anisatin |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 609.5ºC at 760 mmHg |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.31500 |
| Flash Point | 230.1ºC |
| Exact Mass | 328.11600 |
| PSA | 133.52000 |
| Index of Refraction | 1.648 |
| InChIKey | GEVWHIDSUOMVRI-UHFFFAOYSA-N |
| SMILES | CC1CC(O)C2(O)C13CC(OC(=O)C3O)C(C)(O)C21COC1=O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Shikimin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Anisatin? |
| A: Molecular formula of Anisatin is C15H20O8. |
| Q: What is the InChIKey of Anisatin? |
| A: InChIKey of Anisatin is GEVWHIDSUOMVRI-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Anisatin? |
| A: Molecular weight of Anisatin is 328.31500. |
| Q: What is the English name of Anisatin? |
| A: The English name of Anisatin is Anisatin. |
| Q: What is the CAS number of Anisatin? |
| A: CAS number of Anisatin is 51372-90-8. |
| Q: What English synonyms does Anisatin have? |
| A: English synonyms of Anisatin: Shikimin. |
| Q: What is the boiling point of Anisatin? |
| A: Boiling point of Anisatin is 609.5ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of Anisatin? |
| A: Polar surface area (PSA) of Anisatin is 133.52000. |
| Q: What is the SMILES notation of Anisatin? |
| A: SMILES notation of Anisatin is CC1CC(O)C2(O)C13CC(OC(=O)C3O)C(C)(O)C21COC1=O. |
| Q: What is the Chinese name of 51372-90-8? |
| A: Chinese name of 51372-90-8 is 51372-90-8. |