5-(dimethoxymethyl)-1-(4-methylpent-3-enyl)cyclohexene
Modify Date: 2025-08-24 21:11:10
5-(dimethoxymethyl)-1-(4-methylpent-3-enyl)cyclohexene structure
|
Common Name | 5-(dimethoxymethyl)-1-(4-methylpent-3-enyl)cyclohexene | ||
|---|---|---|---|---|
| CAS Number | 51414-22-3 | Molecular Weight | 238.36600 | |
| Density | 0.918g/cm3 | Boiling Point | 292.5ºC at 760mmHg | |
| Molecular Formula | C15H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.1ºC | |
| Name | 5-(dimethoxymethyl)-1-(4-methylpent-3-enyl)cyclohexene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.918g/cm3 |
|---|---|
| Boiling Point | 292.5ºC at 760mmHg |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.36600 |
| Flash Point | 95.1ºC |
| Exact Mass | 238.19300 |
| PSA | 18.46000 |
| LogP | 4.07820 |
| Index of Refraction | 1.469 |
| InChIKey | RYAWURZCWFRNMG-UHFFFAOYSA-N |
| SMILES | COC(OC)C1CCC=C(CCC=C(C)C)C1 |
| HS Code | 2909209000 |
|---|
|
~%
5-(dimethoxymet... CAS#:51414-22-3 |
| Literature: Kogami,K. et al. Canadian Journal of Chemistry, 1974 , vol. 52, p. 125 - 128 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909209000 |
|---|---|
| Summary | 2909209000 other cyclanic, cyclenic or cyclotherpenic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| einecs 257-186-3 |