Benzene,1,3,5-trimethyl-2-[[4-(trifluoromethyl)phenyl]thio]
![Benzene,1,3,5-trimethyl-2-[[4-(trifluoromethyl)phenyl]thio] Structure](https://image.chemsrc.com/caspic/265/51431-75-5.png)
Benzene,1,3,5-trimethyl-2-[[4-(trifluoromethyl)phenyl]thio] structure
|
Common Name | Benzene,1,3,5-trimethyl-2-[[4-(trifluoromethyl)phenyl]thio] | ||
|---|---|---|---|---|
| CAS Number | 51431-75-5 | Molecular Weight | 296.35100 | |
| Density | 1.21g/cm3 | Boiling Point | 326ºC at 760 mmHg | |
| Molecular Formula | C16H15F3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 326ºC at 760 mmHg |
| Molecular Formula | C16H15F3S |
| Molecular Weight | 296.35100 |
| Flash Point | 151ºC |
| Exact Mass | 296.08500 |
| PSA | 25.30000 |
| LogP | 5.78180 |
| Index of Refraction | 1.555 |
| InChIKey | LSSRWXVDMDSZTH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(Sc2ccc(C(F)(F)F)cc2)c(C)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Benzene,1,3,5-t... CAS#:51431-75-5 |
| Literature: Truce,W.E.; Guy,M.M. Journal of Organic Chemistry, 1961 , vol. 26, p. 4331 - 4336 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![Benzene,1,3,5-trimethyl-2-[[4-(trifluoromethyl)phenyl]sulfonyl] structure](https://image.chemsrc.com/caspic/075/848-17-9.png)
CAS#:848-17-9This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene? |
| A: Molecular weight of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene is 296.35100. |
| Q: What is the boiling point of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene? |
| A: Boiling point of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene is 326ºC at 760 mmHg. |
| Q: What is the Chinese name of 51431-75-5? |
| A: Chinese name of 51431-75-5 is 51431-75-5. |
| Q: What is the InChIKey of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene? |
| A: InChIKey of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene is LSSRWXVDMDSZTH-UHFFFAOYSA-N. |
| Q: What are the downstream products of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene? |
| A: Related downstream products(CAS) of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene: 848-17-9. |
| Q: What is the CAS number of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene? |
| A: CAS number of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene is 51431-75-5. |
| Q: What is the molecular formula of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene? |
| A: Molecular formula of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene is C16H15F3S. |
| Q: What is the SMILES notation of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene? |
| A: SMILES notation of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene is Cc1cc(C)c(Sc2ccc(C(F)(F)F)cc2)c(C)c1. |
| Q: What are the upstream materials of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene? |
| A: Related upstream materials(CAS) of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene: 1541-10-2;402-43-7. |
| Q: What is the LogP of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene? |
| A: LogP of 1,3,5-trimethyl-2-[4-(trifluoromethyl)phenyl]sulfanylbenzene is 5.78180. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |