[(3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] acetate structure
|
Common Name | [(3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 51449-93-5 | Molecular Weight | 263.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17NO7 | Melting Point | 174-175ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 174-175ºC |
|---|---|
| Molecular Formula | C10H17NO7 |
| Molecular Weight | 263.24400 |
| Exact Mass | 263.10100 |
| PSA | 125.32000 |
| InChIKey | YNJNXDFAPWSUSI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1C(O)OC(CO)C(O)C1OC(C)=O |
| HS Code | 2924199090 |
|---|
|
~%
[(3R,4R,5S,6R)-... CAS#:51449-93-5 |
| Literature: Tohoku Journal of Experimental Medicine, , vol. 68, p. 313,315 |
|
~%
[(3R,4R,5S,6R)-... CAS#:51449-93-5 |
| Literature: Tohoku Journal of Experimental Medicine, , vol. 68, p. 313,315 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Acetyl-glucosamine 3-Acetate |
| O3-acetyl-2-acetylamino-2-deoxy-D-glucose |
| O3-Acetyl-2-acetylamino-2-desoxy-D-glucose |
| 2-Acetamido-3-O-acetyl-2-deoxy-D-glucopyranose |