1-(2,4-dichlorophenyl)non-1-en-3-one structure
|
Common Name | 1-(2,4-dichlorophenyl)non-1-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 51469-52-4 | Molecular Weight | 285.20900 | |
| Density | 1.138g/cm3 | Boiling Point | 401.3ºC at 760mmHg | |
| Molecular Formula | C15H18Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.6ºC | |
| Name | (E)-1-(2,4-dichlorophenyl)non-1-en-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 401.3ºC at 760mmHg |
| Molecular Formula | C15H18Cl2O |
| Molecular Weight | 285.20900 |
| Flash Point | 169.6ºC |
| Exact Mass | 284.07300 |
| PSA | 17.07000 |
| LogP | 5.54610 |
| Index of Refraction | 1.549 |
| InChIKey | GYUAJPUNRBVZJZ-CSKARUKUSA-N |
| SMILES | CCCCCCC(=O)C=Cc1ccc(Cl)cc1Cl |
|
~%
1-(2,4-dichloro... CAS#:51469-52-4 |
| Literature: Smith,P.J. et al. Canadian Journal of Chemistry, 1972 , vol. 50, p. 871 - 879 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-Nonen-3-one,1-(2,4-dichlorophenyl) |
| (1E)-1-(2,4-Dichlorophenyl)-1-nonen-3-one |
| 1-(2,4-dichlorophenyl)non-1-en-3-one |