1,3-adamantanediethanamine structure
|
Common Name | 1,3-adamantanediethanamine | ||
|---|---|---|---|---|
| CAS Number | 51545-05-2 | Molecular Weight | 222.37000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[3-(2-aminoethyl)-1-adamantyl]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H26N2 |
|---|---|
| Molecular Weight | 222.37000 |
| Exact Mass | 222.21000 |
| PSA | 52.04000 |
| LogP | 3.67120 |
| InChIKey | ABLOCEKNNGBRGT-UHFFFAOYSA-N |
| SMILES | NCCC12CC3CC(C1)CC(CCN)(C3)C2 |
| HS Code | 2921300090 |
|---|
|
~%
1,3-adamantaned... CAS#:51545-05-2 |
| Literature: Aigami,K. et al. Journal of Medicinal Chemistry, 1975 , vol. 18, p. 713 - 721 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921300090 |
|---|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,3-adamantanediethanamine |