2',3'-Di-O-(tert-butyldimethylsilyl)-2'-deoxycytidine structure
|
Common Name | 2',3'-Di-O-(tert-butyldimethylsilyl)-2'-deoxycytidine | ||
|---|---|---|---|---|
| CAS Number | 51549-29-2 | Molecular Weight | 455.73900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H41N3O4Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3',5'-O-bis(tert-butyldimethylsilyl)dc |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H41N3O4Si2 |
|---|---|
| Molecular Weight | 455.73900 |
| Exact Mass | 455.26400 |
| PSA | 88.60000 |
| LogP | 5.10640 |
| InChIKey | CKWHPVGBUBYJIT-LZLYRXPVSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(n2ccc(N)nc2=O)CC1O[Si](C)(C)C(C)(C)C |
| Storage condition | 2-8°C |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Name: High-throughput screen for inhibitors of the GIV GBA-motif interaction with Galpha-i ...
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS1303
|
| 2',3'-Di-O-(tert-butyldimethylsilyl)-2'-deoxycytidine |