5'-O-TBDMS-dA
5'-O-TBDMS-dA structure
|
Common Name | 5'-O-TBDMS-dA | ||
|---|---|---|---|---|
| CAS Number | 51549-30-5 | Molecular Weight | 365.50300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H27N5O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'-O-TBDMS-dA5'-O-TBDMS-dA is a modified nucleoside and can be used to synthesize DNA or RNA. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol |
|---|
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | 5'-O-TBDMS-dA is a modified nucleoside and can be used to synthesize DNA or RNA. |
|---|---|
| Related Catalog |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H27N5O3Si |
|---|---|
| Molecular Weight | 365.50300 |
| Exact Mass | 365.18800 |
| PSA | 108.31000 |
| LogP | 2.65990 |
| InChIKey | HGLRBQHXIBHZTD-QJPTWQEYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(n2cnc3c(N)ncnc32)CC1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol? |
| A: The English name of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol is (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol. |
| Q: What is the Chinese name of 51549-30-5? |
| A: Chinese name of 51549-30-5 is 5'-O-TBDMS-dA. |
| Q: What is the SMILES notation of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol? |
| A: SMILES notation of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol is CC(C)(C)[Si](C)(C)OCC1OC(n2cnc3c(N)ncnc32)CC1O. |
| Q: What is the LogP of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol? |
| A: LogP of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol is 2.65990. |
| Q: What is the polar surface area (PSA) of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol? |
| A: Polar surface area (PSA) of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol is 108.31000. |
| Q: What is the InChIKey of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol? |
| A: InChIKey of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol is HGLRBQHXIBHZTD-QJPTWQEYSA-N. |
| Q: What is the CAS number of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol? |
| A: CAS number of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol is 51549-30-5. |
| Q: What is the molecular formula of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol? |
| A: Molecular formula of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol is C16H27N5O3Si. |
| Q: What are the uses of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol? |
| A: Main uses of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol: 5'-O-TBDMS-dA is a modified nucleoside and can be used to synthesize DNA or RNA. |
| Q: What is the molecular weight of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol? |
| A: Molecular weight of (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-ol is 365.50300. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |