3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine
3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine structure
|
Common Name | 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine | ||
|---|---|---|---|---|
| CAS Number | 51549-47-4 | Molecular Weight | 415.39700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H21N3O7 |
|---|---|
| Molecular Weight | 415.39700 |
| Exact Mass | 415.13800 |
| PSA | 125.82000 |
| LogP | 1.35090 |
| InChIKey | RZBZCUISIQLULR-LZLYRXPVSA-N |
| SMILES | CC(=O)OCC1OC(n2ccc(NC(=O)c3ccccc3)nc2=O)CC1OC(C)=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:958-09-8
CAS#:23526-11-6
CAS#:3413-66-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| O3',O5'-diacetyl-N4-benzoyl-2'-deoxy-cytidine |
| diOAc-dC-NBz |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine? |
| A: LogP of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine is 1.35090. |
| Q: What is the molecular weight of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine? |
| A: Molecular weight of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine is 415.39700. |
| Q: What is the polar surface area (PSA) of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine? |
| A: Polar surface area (PSA) of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine is 125.82000. |
| Q: What is the InChIKey of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine? |
| A: InChIKey of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine is RZBZCUISIQLULR-LZLYRXPVSA-N. |
| Q: What is the SMILES notation of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine? |
| A: SMILES notation of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine is CC(=O)OCC1OC(n2ccc(NC(=O)c3ccccc3)nc2=O)CC1OC(C)=O. |
| Q: What English synonyms does 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine have? |
| A: English synonyms of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine: O3',O5'-diacetyl-N4-benzoyl-2'-deoxy-cytidine, diOAc-dC-NBz. |
| Q: What is the Chinese name of 51549-47-4? |
| A: Chinese name of 51549-47-4 is 51549-47-4. |
| Q: What is the CAS number of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine? |
| A: CAS number of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine is 51549-47-4. |
| Q: What is the molecular formula of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine? |
| A: Molecular formula of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine is C20H21N3O7. |
| Q: What are the downstream products of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine? |
| A: Related downstream products(CAS) of 3',5'-di-O-acetyl-N4-benzoyl-2'-deoxycytidine: 958-09-8;23526-11-6;3413-66-9. |