N-(4-methoxy-2-nitro-phenyl)diazenyl-N-methyl-methanamine
Modify Date: 2025-09-13 15:13:06
N-(4-methoxy-2-nitro-phenyl)diazenyl-N-methyl-methanamine structure
|
Common Name | N-(4-methoxy-2-nitro-phenyl)diazenyl-N-methyl-methanamine | ||
|---|---|---|---|---|
| CAS Number | 51553-22-1 | Molecular Weight | 224.21700 | |
| Density | 1.25g/cm3 | Boiling Point | 354.9ºC at 760 mmHg | |
| Molecular Formula | C9H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.4ºC | |
| Name | N-[(4-methoxy-2-nitrophenyl)diazenyl]-N-methylmethanamine |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 354.9ºC at 760 mmHg |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.21700 |
| Flash Point | 168.4ºC |
| Exact Mass | 224.09100 |
| PSA | 83.01000 |
| LogP | 2.68690 |
| Index of Refraction | 1.563 |
| InChIKey | WHZMSJACTYCRAR-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=NN(C)C)c([N+](=O)[O-])c1 |
| HS Code | 2928000090 |
|---|
|
~%
N-(4-methoxy-2-... CAS#:51553-22-1 |
| Literature: Rondestvedt; Davis Journal of Organic Chemistry, 1957 , vol. 22, p. 200,203 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |