1-[1-(2,2-Dimethylhydrazino)ethyl]-2-ethyldiazene
Modify Date: 2024-02-05 17:05:38
![1-[1-(2,2-Dimethylhydrazino)ethyl]-2-ethyldiazene Structure](https://image.chemsrc.com/caspic/279/51576-31-9.png)
1-[1-(2,2-Dimethylhydrazino)ethyl]-2-ethyldiazene structure
|
Common Name | 1-[1-(2,2-Dimethylhydrazino)ethyl]-2-ethyldiazene | ||
|---|---|---|---|---|
| CAS Number | 51576-31-9 | Molecular Weight | 144.21800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H16N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[1-(ethyldiazenyl)ethyl]-1,1-dimethylhydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H16N4 |
|---|---|
| Molecular Weight | 144.21800 |
| Exact Mass | 144.13700 |
| PSA | 39.99000 |
| LogP | 1.26160 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (E)-1-[1-(2,2-Dimethylhydrazino)ethyl]-2-ethyldiazene |
| BABHWMHGOCZGSO-BQYQJAHWSA |
| InChI=1/C6H16N4/c1-5-7-8-6(2)9-10(3)4/h6,9H,5H2,1-4H3/b8-7+ |
| 1-[1-(2,2-Dimethylhydrazino)ethyl]-2-ethyldiazene |
| Diazene,[1-(2,2-dimethylhydrazino)ethyl]ethyl |