(3-Bromo-4-Methyl-phenyl)-carbamic acid tert-butyl ester structure
|
Common Name | (3-Bromo-4-Methyl-phenyl)-carbamic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 515813-02-2 | Molecular Weight | 286.16500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-(3-bromo-4-methylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16BrNO2 |
|---|---|
| Molecular Weight | 286.16500 |
| Exact Mass | 285.03600 |
| PSA | 41.82000 |
| LogP | 4.11810 |
| InChIKey | DNOLDJLTBWGCQD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)OC(C)(C)C)cc1Br |
|
~98%
(3-Bromo-4-Meth... CAS#:515813-02-2 |
| Literature: GALDERMA RESEARCH and DEVELOPMENT, S.N.C. Patent: WO2006/18326 A1, 2006 ; Location in patent: Page/Page column 46; 47 ; WO 2006/018326 A1 |
|
~62%
(3-Bromo-4-Meth... CAS#:515813-02-2 |
| Literature: Angell, Richard; Aston, Nicola M.; Bamborough, Paul; Buckton, Jacky B.; Cockerill, Stuart; deBoeck, Suzanne J.; Edwards, Chris D.; Holmes, Duncan S.; Jones, Katherine L.; Laine, Dramane I.; Patel, Shila; Smee, Penny A.; Smith, Kathryn J.; Somers, Don O.; Walker, Ann L. Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 15 p. 4428 - 4432 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Carbamic acid,(3-bromo-4-methylphenyl)-,1,1-dimethylethyl ester |
| tert-Butyl (3-bromo-4-methylphenyl)carbamate |
| QC-8575 |