Methyl 6-Fluoroindole-3-acetate
Modify Date: 2026-08-13 18:09:41
Methyl 6-Fluoroindole-3-acetate structure
|
Common Name | Methyl 6-Fluoroindole-3-acetate | ||
|---|---|---|---|---|
| CAS Number | 5159-07-9 | Molecular Weight | 207.2 | |
| Density | 1.304±0.06 g/cm3(Predicted) | Boiling Point | 345.3±27.0 °C(Predicted) | |
| Molecular Formula | C11H10FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.6±23.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 6-Fluoroindole-3-acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.304±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 345.3±27.0 °C(Predicted) |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.2 |
| Flash Point | 162.6±23.7 °C |
| Exact Mass | 207.069550 |
| LogP | 1.94 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | AVSUEWDZNVTLFF-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1c[nH]c2cc(F)ccc12 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Indole-3-acetic acid, 6-fluoro-, methyl ester |
| MFCD24392343 |
| Methyl (6-fluoro-1H-indol-3-yl)acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 6-Fluoroindole-3-acetate? |
| A: The English name of Methyl 6-Fluoroindole-3-acetate is Methyl 6-Fluoroindole-3-acetate. |
| Q: What English synonyms does Methyl 6-Fluoroindole-3-acetate have? |
| A: English synonyms of Methyl 6-Fluoroindole-3-acetate: 1H-Indole-3-acetic acid, 6-fluoro-, methyl ester, MFCD24392343, Methyl (6-fluoro-1H-indol-3-yl)acetate. |
| Q: What is the CAS number of Methyl 6-Fluoroindole-3-acetate? |
| A: CAS number of Methyl 6-Fluoroindole-3-acetate is 5159-07-9. |
| Q: What is the InChIKey of Methyl 6-Fluoroindole-3-acetate? |
| A: InChIKey of Methyl 6-Fluoroindole-3-acetate is AVSUEWDZNVTLFF-UHFFFAOYSA-N. |
| Q: What is the LogP of Methyl 6-Fluoroindole-3-acetate? |
| A: LogP of Methyl 6-Fluoroindole-3-acetate is 1.94. |
| Q: What is the molecular formula of Methyl 6-Fluoroindole-3-acetate? |
| A: Molecular formula of Methyl 6-Fluoroindole-3-acetate is C11H10FNO2. |
| Q: What is the SMILES notation of Methyl 6-Fluoroindole-3-acetate? |
| A: SMILES notation of Methyl 6-Fluoroindole-3-acetate is COC(=O)Cc1c[nH]c2cc(F)ccc12. |
| Q: What is the molecular weight of Methyl 6-Fluoroindole-3-acetate? |
| A: Molecular weight of Methyl 6-Fluoroindole-3-acetate is 207.2. |
| Q: What is the boiling point of Methyl 6-Fluoroindole-3-acetate? |
| A: Boiling point of Methyl 6-Fluoroindole-3-acetate is 345.3±27.0 °C(Predicted). |