7-bromo-naphthalene-2-carboxylic acid methyl ester
7-bromo-naphthalene-2-carboxylic acid methyl ester structure
|
Common Name | 7-bromo-naphthalene-2-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 5159-63-7 | Molecular Weight | 265.10300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-bromo-naphthalene-2-carboxylic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H9BrO2 |
|---|---|
| Molecular Weight | 265.10300 |
| Exact Mass | 263.97900 |
| PSA | 26.30000 |
| LogP | 3.38890 |
| InChIKey | COJFEPBVZMXUES-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2ccc(Br)cc2c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:5043-14-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl 7-bromo-2-naphthoate |
| methyl 7-bromo-2-naphthalenecarboxylate |
| 7-bromonaphthalene-2-carboxylic acid methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 7-bromo-naphthalene-2-carboxylic acid methyl ester? |
| A: InChIKey of 7-bromo-naphthalene-2-carboxylic acid methyl ester is COJFEPBVZMXUES-UHFFFAOYSA-N. |
| Q: What English synonyms does 7-bromo-naphthalene-2-carboxylic acid methyl ester have? |
| A: English synonyms of 7-bromo-naphthalene-2-carboxylic acid methyl ester: methyl 7-bromo-2-naphthoate, methyl 7-bromo-2-naphthalenecarboxylate, 7-bromonaphthalene-2-carboxylic acid methyl ester. |
| Q: What is the LogP of 7-bromo-naphthalene-2-carboxylic acid methyl ester? |
| A: LogP of 7-bromo-naphthalene-2-carboxylic acid methyl ester is 3.38890. |
| Q: What is the polar surface area (PSA) of 7-bromo-naphthalene-2-carboxylic acid methyl ester? |
| A: Polar surface area (PSA) of 7-bromo-naphthalene-2-carboxylic acid methyl ester is 26.30000. |
| Q: What is the English name of 7-bromo-naphthalene-2-carboxylic acid methyl ester? |
| A: The English name of 7-bromo-naphthalene-2-carboxylic acid methyl ester is 7-bromo-naphthalene-2-carboxylic acid methyl ester. |
| Q: What is the molecular formula of 7-bromo-naphthalene-2-carboxylic acid methyl ester? |
| A: Molecular formula of 7-bromo-naphthalene-2-carboxylic acid methyl ester is C12H9BrO2. |
| Q: What is the CAS number of 7-bromo-naphthalene-2-carboxylic acid methyl ester? |
| A: CAS number of 7-bromo-naphthalene-2-carboxylic acid methyl ester is 5159-63-7. |
| Q: What are the downstream products of 7-bromo-naphthalene-2-carboxylic acid methyl ester? |
| A: Related downstream products(CAS) of 7-bromo-naphthalene-2-carboxylic acid methyl ester: 5043-14-1. |
| Q: What is the Chinese name of 5159-63-7? |
| A: Chinese name of 5159-63-7 is 5159-63-7. |
| Q: What is the SMILES notation of 7-bromo-naphthalene-2-carboxylic acid methyl ester? |
| A: SMILES notation of 7-bromo-naphthalene-2-carboxylic acid methyl ester is COC(=O)c1ccc2ccc(Br)cc2c1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |