Thiourea, N,N-[4-(4-nitrophenyl)-1,2,4-dithiazolidine-3,5-diylidene]bis[N,N-dimethyl- structure
|
Common Name | Thiourea, N,N-[4-(4-nitrophenyl)-1,2,4-dithiazolidine-3,5-diylidene]bis[N,N-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 51593-13-6 | Molecular Weight | 428.57600 | |
| Density | 1.47g/cm3 | Boiling Point | 551.6ºC at 760 mmHg | |
| Molecular Formula | C14H16N6O2S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.4ºC | |
| Name | (3Z)-3-[(5Z)-5-(dimethylcarbamothioylimino)-4-(4-nitrophenyl)-1,2,4-dithiazolidin-3-ylidene]-1,1-dimethylthiourea |
|---|
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 551.6ºC at 760 mmHg |
| Molecular Formula | C14H16N6O2S4 |
| Molecular Weight | 428.57600 |
| Flash Point | 287.4ºC |
| Exact Mass | 428.02200 |
| PSA | 202.61000 |
| LogP | 2.52610 |
| Index of Refraction | 1.721 |
| InChIKey | ZRPIUNXNSNJTNS-VMNXYWKNSA-N |
| SMILES | CN(C)C(=S)N=c1ssc(=NC(=S)N(C)C)n1-c1ccc([N+](=O)[O-])cc1 |
|
~%
Thiourea, N,N-[... CAS#:51593-13-6 |
| Literature: Oliver; Brown Journal of Organic Chemistry, 1974 , vol. 39, # 15 p. 2228 - 2233 |
|
~%
Thiourea, N,N-[... CAS#:51593-13-6 |
| Literature: Goerdeler,J.; Ulmen,J. Chemische Berichte, 1972 , vol. 105, p. 1568 - 1577 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |