4,4'-DINITRO-[2,2'-BIPYRIDINE] 1,1'-DIOXIDE structure
|
Common Name | 4,4'-DINITRO-[2,2'-BIPYRIDINE] 1,1'-DIOXIDE | ||
|---|---|---|---|---|
| CAS Number | 51595-55-2 | Molecular Weight | 278.17800 | |
| Density | 1.70±0.1 g/cm3(Predicted) | Boiling Point | 744.5±60.0 ℃(Predicted) | |
| Molecular Formula | C10H6N4O6 | Melting Point | 261 ℃ (decomp) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitro-2-(4-nitro-1-oxidopyridin-2-ylidene)pyridin-1-ium 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.70±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 744.5±60.0 ℃(Predicted) |
| Melting Point | 261 ℃ (decomp) |
| Molecular Formula | C10H6N4O6 |
| Molecular Weight | 278.17800 |
| Exact Mass | 278.02900 |
| PSA | 142.56000 |
| LogP | 3.07340 |
| InChIKey | QVRTYCMSRZUOJO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C1=CC(=C2C=C([N+](=O)[O-])C=C[N+]2=O)N([O-])C=C1 |
| HS Code | 2933399090 |
|---|
|
~86%
4,4'-DINITRO-[2... CAS#:51595-55-2 |
| Literature: Kavanagh, Paul; Leech, Donal Tetrahedron Letters, 2004 , vol. 45, # 1 p. 121 - 123 |
|
~%
4,4'-DINITRO-[2... CAS#:51595-55-2 |
| Literature: Carlson, Brenden; Phelan, Gregory D.; Kaminsky, Werner; Dalton, Larry; Jiang, Xuezhong; Liu, Sen; Jen, Alex K.-Y. Journal of the American Chemical Society, 2002 , vol. 124, # 47 p. 14162 - 14172 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,4'-dinitro-[2,2']bipyridinyl 1,1-dioxide |
| 4,4'-dinitro-2,2'-bipyridyl-N,N'-dioxide |
| 4,4'-dinitro-2,2'-bipyridine N,N'-dioxide |
| 4,4'-dinitro-[2,2']-bipyridine-[1,1']-dioxide |