22,23-dihydroergosterol, non-irradiated
22,23-dihydroergosterol, non-irradiated structure
|
Common Name | 22,23-dihydroergosterol, non-irradiated | ||
|---|---|---|---|---|
| CAS Number | 516-79-0 | Molecular Weight | 398.66400 | |
| Density | 0.99g/cm3 | Boiling Point | 502.1ºC at 760mmHg | |
| Molecular Formula | C28H46O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ergosta-5,7-dien-3β-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 502.1ºC at 760mmHg |
| Molecular Formula | C28H46O |
| Molecular Weight | 398.66400 |
| Flash Point | 217.2ºC |
| Exact Mass | 398.35500 |
| PSA | 20.23000 |
| LogP | 7.55480 |
| Index of Refraction | 1.532 |
| InChIKey | ZKQRGSXITBHHPC-VVQHAZRASA-N |
| SMILES | CC(C)C(C)CCC(C)C1CCC2C3=CC=C4CC(O)CCC4(C)C3CCC21C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:42152-47-6
CAS#:3070-53-9
CAS#:763-13-3
CAS#:16744-89-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ergosta-5,7-dien-3beta-ol |
| Ergosta-5,7-dien-3-ol |
| 22,23-Dihydroergosterol Discontinued |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of ergosta-5,7-dien-3β-ol? |
| A: LogP of ergosta-5,7-dien-3β-ol is 7.55480. |
| Q: What is the SMILES notation of ergosta-5,7-dien-3β-ol? |
| A: SMILES notation of ergosta-5,7-dien-3β-ol is CC(C)C(C)CCC(C)C1CCC2C3=CC=C4CC(O)CCC4(C)C3CCC21C. |
| Q: What is the polar surface area (PSA) of ergosta-5,7-dien-3β-ol? |
| A: Polar surface area (PSA) of ergosta-5,7-dien-3β-ol is 20.23000. |
| Q: What is the CAS number of ergosta-5,7-dien-3β-ol? |
| A: CAS number of ergosta-5,7-dien-3β-ol is 516-79-0. |
| Q: What is the boiling point of ergosta-5,7-dien-3β-ol? |
| A: Boiling point of ergosta-5,7-dien-3β-ol is 502.1ºC at 760mmHg. |
| Q: What is the English name of ergosta-5,7-dien-3β-ol? |
| A: The English name of ergosta-5,7-dien-3β-ol is ergosta-5,7-dien-3β-ol. |
| Q: What are the downstream products of ergosta-5,7-dien-3β-ol? |
| A: Related downstream products(CAS) of ergosta-5,7-dien-3β-ol: 42152-47-6;3070-53-9;763-13-3;16744-89-1. |
| Q: What is the InChIKey of ergosta-5,7-dien-3β-ol? |
| A: InChIKey of ergosta-5,7-dien-3β-ol is ZKQRGSXITBHHPC-VVQHAZRASA-N. |
| Q: What is the molecular formula of ergosta-5,7-dien-3β-ol? |
| A: Molecular formula of ergosta-5,7-dien-3β-ol is C28H46O. |
| Q: What English synonyms does ergosta-5,7-dien-3β-ol have? |
| A: English synonyms of ergosta-5,7-dien-3β-ol: ergosta-5,7-dien-3beta-ol, Ergosta-5,7-dien-3-ol, 22,23-Dihydroergosterol Discontinued. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |