7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine,3-(5,6-dihydrodibenzo[2,1-b:2',1'-f][7]annulen-11-ylidene)-N,N-dimethylpropan-1-amine,hydrochloride structure
|
Common Name | 7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine,3-(5,6-dihydrodibenzo[2,1-b:2',1'-f][7]annulen-11-ylidene)-N,N-dimethylpropan-1-amine,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 51602-26-7 | Molecular Weight | 613.61900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H38Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine,3-(5,6-dihydrodibenzo[2,1-b:2',1'-f][7]annulen-11-ylidene)-N,N-dimethylpropan-1-amine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C36H38Cl2N4O |
|---|---|
| Molecular Weight | 613.61900 |
| Exact Mass | 612.24200 |
| PSA | 51.43000 |
| LogP | 6.19330 |
| InChIKey | FWDRASJBHDJLHC-UHFFFAOYSA-N |
| SMILES | CN(C)CCC=C1c2ccccc2CCc2ccccc21.CN=C1CN(O)C(c2ccccc2)=c2cc(Cl)ccc2=N1.Cl |
| Chlordiazepoxide,mixture with Amitriptyline hydrochloride |
| Chlordiazepoxide mixture with amitriptyline |