N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide
N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide structure
|
Common Name | N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 51639-75-9 | Molecular Weight | 251.66600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10ClNO3 |
|---|---|
| Molecular Weight | 251.66600 |
| Exact Mass | 251.03500 |
| PSA | 53.68000 |
| LogP | 3.27740 |
| InChIKey | RSGVVQNJJVEPJG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(O)C(=O)c2ccco2)cc1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(3-chloro-4-m... CAS#:51639-75-9 |
| Literature: Velsicol Chemical Corporation Patent: US3982922 A1, 1976 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:51639-85-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Furancarboxamide,N-(3-chloro-4-methylphenyl)-N-hydroxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide? |
| A: InChIKey of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide is RSGVVQNJJVEPJG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 51639-75-9? |
| A: Chinese name of 51639-75-9 is 51639-75-9. |
| Q: What is the polar surface area (PSA) of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide? |
| A: Polar surface area (PSA) of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide is 53.68000. |
| Q: What are the upstream materials of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide? |
| A: Related upstream materials(CAS) of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide: 527-69-5;34634-76-9. |
| Q: What English synonyms does N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide have? |
| A: English synonyms of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide: 2-Furancarboxamide,N-(3-chloro-4-methylphenyl)-N-hydroxy. |
| Q: What is the SMILES notation of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide? |
| A: SMILES notation of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide is Cc1ccc(N(O)C(=O)c2ccco2)cc1Cl. |
| Q: What is the molecular formula of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide? |
| A: Molecular formula of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide is C12H10ClNO3. |
| Q: What is the English name of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide? |
| A: The English name of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide is N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide. |
| Q: What is the CAS number of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide? |
| A: CAS number of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide is 51639-75-9. |
| Q: What is the molecular weight of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide? |
| A: Molecular weight of N-(3-chloro-4-methylphenyl)-N-hydroxyfuran-2-carboxamide is 251.66600. |