N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide
N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide structure
|
Common Name | N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 51639-86-2 | Molecular Weight | 286.11100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide (Chinese name: N-(3,4-二氯苯基)-N-甲氧基呋喃-2-羧酰胺, CAS number: 51639-86-2), molecular formula: C12H9Cl2NO3, molecular weight: 286.11100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H9Cl2NO3 |
|---|---|
| Molecular Weight | 286.11100 |
| Exact Mass | 284.99600 |
| PSA | 42.68000 |
| LogP | 3.79460 |
| InChIKey | HOHVBQGCWSPBBZ-UHFFFAOYSA-N |
| SMILES | CON(C(=O)c1ccco1)c1ccc(Cl)c(Cl)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(3,4-dichloro... CAS#:51639-86-2 |
| Literature: Velsicol Chemical Corporation Patent: US3982922 A1, 1976 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Furancarboxamide,N-(3,4-dichlorophenyl)-N-methoxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide? |
| A: Molecular formula of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide is C12H9Cl2NO3. |
| Q: What is the Chinese name of 51639-86-2? |
| A: Chinese name of 51639-86-2 is 51639-86-2. |
| Q: What are the upstream materials of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide? |
| A: Related upstream materials(CAS) of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide: 51639-76-0. |
| Q: What is the molecular weight of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide? |
| A: Molecular weight of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide is 286.11100. |
| Q: What is the SMILES notation of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide? |
| A: SMILES notation of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide is CON(C(=O)c1ccco1)c1ccc(Cl)c(Cl)c1. |
| Q: What English synonyms does N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide have? |
| A: English synonyms of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide: 2-Furancarboxamide,N-(3,4-dichlorophenyl)-N-methoxy. |
| Q: What is the CAS number of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide? |
| A: CAS number of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide is 51639-86-2. |
| Q: What is the InChIKey of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide? |
| A: InChIKey of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide is HOHVBQGCWSPBBZ-UHFFFAOYSA-N. |
| Q: What is the LogP of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide? |
| A: LogP of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide is 3.79460. |
| Q: What is the polar surface area (PSA) of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide? |
| A: Polar surface area (PSA) of N-(3,4-dichlorophenyl)-N-methoxyfuran-2-carboxamide is 42.68000. |