bicyclo[3.1.1]heptane-3,3-dicarboxylic acid structure
|
Common Name | bicyclo[3.1.1]heptane-3,3-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 5164-32-9 | Molecular Weight | 184.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bicyclo[3.1.1]heptane-3,3-dicarboxylic acid |
|---|
| Molecular Formula | C9H12O4 |
|---|---|
| Molecular Weight | 184.18900 |
| Exact Mass | 184.07400 |
| PSA | 74.60000 |
| LogP | 0.96200 |
| InChIKey | NGXQMCXOIGSTNL-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(C(=O)O)CC2CC(C2)C1 |
| HS Code | 2917209090 |
|---|
|
~%
bicyclo[3.1.1]h... CAS#:5164-32-9 |
| Literature: Musso,H. et al. Chemische Berichte, 1967 , vol. 100, p. 3614 - 3624 |
|
~%
bicyclo[3.1.1]h... CAS#:5164-32-9 |
| Literature: Musso,H.; Naumann,K. Angewandte Chemie, 1966 , vol. 78, # 1 p. 116 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |