2-Naphthalenecarboxamide,N-(4-chloro-2-methoxy-5-methylphenyl)-3-hydroxy- structure
|
Common Name | 2-Naphthalenecarboxamide,N-(4-chloro-2-methoxy-5-methylphenyl)-3-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 5165-81-1 | Molecular Weight | 341.78800 | |
| Density | 1.35g/cm3 | Boiling Point | 458.9ºC at 760mmHg | |
| Molecular Formula | C19H16ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.4ºC | |
| Name | N-(4-chloro-2-methoxy-5-methylphenyl)-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 458.9ºC at 760mmHg |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.78800 |
| Flash Point | 231.4ºC |
| Exact Mass | 341.08200 |
| PSA | 58.56000 |
| LogP | 4.84110 |
| Index of Refraction | 1.692 |
| InChIKey | COXPEQKIFMVQIO-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)c1cc2ccccc2cc1O |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 225-946-3 |
| 2-Naphthalenecarboxamide,N-(4-chloro-2-methoxy-5-methylphenyl)-3-hydroxy |
| C.I. Azoic Coupling Component 28 |