1,3,5-Triphenylbarbituric acid
Modify Date: 2025-09-17 18:00:03
1,3,5-Triphenylbarbituric acid structure
|
Common Name | 1,3,5-Triphenylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 5167-31-7 | Molecular Weight | 356.37400 | |
| Density | 1.316g/cm3 | Boiling Point | 514.6ºC at 760 mmHg | |
| Molecular Formula | C22H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.1ºC | |
| Name | 1,3,5-triphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 514.6ºC at 760 mmHg |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.37400 |
| Flash Point | 227.1ºC |
| Exact Mass | 356.11600 |
| PSA | 57.69000 |
| LogP | 4.10020 |
| Index of Refraction | 1.654 |
| InChIKey | WZQPYEJQKDEYJQ-UHFFFAOYSA-N |
| SMILES | O=C1C(c2ccccc2)C(=O)N(c2ccccc2)C(=O)N1c1ccccc1 |
| HS Code | 2933540000 |
|---|
|
~64%
1,3,5-Triphenyl... CAS#:5167-31-7 |
| Literature: Stadlbauer, Wolfgang; Kappe, Thomas Monatshefte fuer Chemie, 1985 , vol. 116, p. 1005 - 1016 |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| Barbituric acid,1,3,5-triphenyl |
| 1,3,5-Triphenylbarbituric acid |