2-[(2,4-dichloronaphthalen-1-yl)amino]benzoic acid
Modify Date: 2025-08-29 11:33:10
![2-[(2,4-dichloronaphthalen-1-yl)amino]benzoic acid Structure](https://image.chemsrc.com/caspic/408/51671-08-0.png)
2-[(2,4-dichloronaphthalen-1-yl)amino]benzoic acid structure
|
Common Name | 2-[(2,4-dichloronaphthalen-1-yl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 51671-08-0 | Molecular Weight | 332.18100 | |
| Density | 1.469g/cm3 | Boiling Point | 469.2ºC at 760 mmHg | |
| Molecular Formula | C17H11Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.6ºC | |
| Name | 2-[(2,4-dichloronaphthalen-1-yl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 469.2ºC at 760 mmHg |
| Molecular Formula | C17H11Cl2NO2 |
| Molecular Weight | 332.18100 |
| Flash Point | 237.6ºC |
| Exact Mass | 331.01700 |
| PSA | 49.33000 |
| LogP | 5.66140 |
| Index of Refraction | 1.729 |
| InChIKey | IIYRDOASPQJNPK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1c(Cl)cc(Cl)c2ccccc12 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid,2-((2,4-dichloro-1-naphthalenyl)amino) |
| N-(2,4-Dichloro-1-naphthyl)anthranilic acid |
| N-(2,4-DICHLORO-NAPHTHALEN-1-YL)ANTHRANILIC ACID |
| 2-((2,4-Dichloro-1-naphthalenyl)amino)benzoic acid |