Norpluviine structure
|
Common Name | Norpluviine | ||
|---|---|---|---|---|
| CAS Number | 517-99-7 | Molecular Weight | 273.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Norpluviine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H19NO3 |
|---|---|
| Molecular Weight | 273.33 |
| InChIKey | KYCRETLRESMMIM-DAXOMENPSA-N |
| SMILES | COc1cc2c(cc1O)CN1CCC3=CCC(O)C2C31 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Norpluviine? |
| A: The English name of Norpluviine is Norpluviine. |
| Q: What is the SMILES notation of Norpluviine? |
| A: SMILES notation of Norpluviine is COc1cc2c(cc1O)CN1CCC3=CCC(O)C2C31. |
| Q: What is the InChIKey of Norpluviine? |
| A: InChIKey of Norpluviine is KYCRETLRESMMIM-DAXOMENPSA-N. |
| Q: What is the CAS number of Norpluviine? |
| A: CAS number of Norpluviine is 517-99-7. |
| Q: What is the Chinese name of 517-99-7? |
| A: Chinese name of 517-99-7 is 517-99-7. |
| Q: What is the molecular weight of Norpluviine? |
| A: Molecular weight of Norpluviine is 273.33. |
| Q: What is the molecular formula of Norpluviine? |
| A: Molecular formula of Norpluviine is C16H19NO3. |