6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine
6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine structure
|
Common Name | 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 51706-27-5 | Molecular Weight | 250.27700 | |
| Density | 1.482g/cm3 | Boiling Point | 630.5ºC at 760 mmHg | |
| Molecular Formula | C10H10N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 335.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.482g/cm3 |
|---|---|
| Boiling Point | 630.5ºC at 760 mmHg |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.27700 |
| Flash Point | 335.1ºC |
| Exact Mass | 250.05200 |
| PSA | 120.34000 |
| LogP | 2.71700 |
| Index of Refraction | 1.67 |
| InChIKey | RCOWHCZLRLBOKU-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(N)cn2)nc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-(5-aminopyrid... CAS#:51706-27-5 |
| Literature: Bambas Journal of the American Chemical Society, 1945 , vol. 67, p. 668 |
|
~%
6-(5-aminopyrid... CAS#:51706-27-5 |
| Literature: Surrey; Lindwall Journal of the American Chemical Society, 1940 , vol. 62, p. 173 |
|
~%
6-(5-aminopyrid... CAS#:51706-27-5 |
| Literature: Surrey; Lindwall Journal of the American Chemical Society, 1940 , vol. 62, p. 173 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2'-Sulfonylbis(5-aminopyridine) |
| Pyridine,2,2'-sulfonylbis(5-amino |
| 3-Pyridinamine,6,6'-sulfonylbis |
| Bis(5-aminopyridyl-2)sulfone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine? |
| A: Molecular formula of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine is C10H10N4O2S. |
| Q: What is the polar surface area (PSA) of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine? |
| A: Polar surface area (PSA) of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine is 120.34000. |
| Q: What is the SMILES notation of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine? |
| A: SMILES notation of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine is Nc1ccc(S(=O)(=O)c2ccc(N)cn2)nc1. |
| Q: What is the molecular weight of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine? |
| A: Molecular weight of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine is 250.27700. |
| Q: What is the boiling point of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine? |
| A: Boiling point of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine is 630.5ºC at 760 mmHg. |
| Q: What English synonyms does 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine have? |
| A: English synonyms of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine: 2,2'-Sulfonylbis(5-aminopyridine), Pyridine,2,2'-sulfonylbis(5-amino, 3-Pyridinamine,6,6'-sulfonylbis, Bis(5-aminopyridyl-2)sulfone. |
| Q: What is the LogP of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine? |
| A: LogP of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine is 2.71700. |
| Q: What is the InChIKey of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine? |
| A: InChIKey of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine is RCOWHCZLRLBOKU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 51706-27-5? |
| A: Chinese name of 51706-27-5 is 51706-27-5. |
| Q: What is the CAS number of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine? |
| A: CAS number of 6-(5-aminopyridin-2-yl)sulfonylpyridin-3-amine is 51706-27-5. |