2,2,4,4,5,5,7,7-Octamethyloctane structure
|
Common Name | 2,2,4,4,5,5,7,7-Octamethyloctane | ||
|---|---|---|---|---|
| CAS Number | 5171-85-7 | Molecular Weight | 226.441 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 263.0±7.0 °C at 760 mmHg | |
| Molecular Formula | C16H34 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.5±11.7 °C | |
| Name | 2,2,4,4,5,5,7,7-octamethyloctane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 263.0±7.0 °C at 760 mmHg |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.441 |
| Flash Point | 112.5±11.7 °C |
| Exact Mass | 226.266052 |
| LogP | 7.79 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.433 |
| InChIKey | QGGICMFBIPBAOB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C(C)(C)CC(C)(C)C |
|
~5%
2,2,4,4,5,5,7,7... CAS#:5171-85-7 |
| Literature: Winiker, Robert; Beckhaus, Hans-Dieter; Ruechardt, Christoph Chemische Berichte, 1980 , vol. 113, # 11 p. 3456 - 3476 |
|
~%
2,2,4,4,5,5,7,7... CAS#:5171-85-7 |
| Literature: Anderson,J.E.; Pearson,H. Journal of the American Chemical Society, 1975 , vol. 97, p. 764 - 769 |
| 2,2,4,4,5,5,7,7-Octamethyloctane |
| Octane,2,2,4,4,5,5,7,7-octamethyl |
| Octane, 2,2,4,4,5,5,7,7-octamethyl- |