N-[(4-methoxyphenyl)methyl]-3-oxo-butanamide structure
|
Common Name | N-[(4-methoxyphenyl)methyl]-3-oxo-butanamide | ||
|---|---|---|---|---|
| CAS Number | 51719-12-1 | Molecular Weight | 221.25200 | |
| Density | 1.112g/cm3 | Boiling Point | 436.4ºC at 760 mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.7ºC | |
| Name | N-(4-methoxybenzyl)-3-oxobutanamide |
|---|
| Density | 1.112g/cm3 |
|---|---|
| Boiling Point | 436.4ºC at 760 mmHg |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Flash Point | 217.7ºC |
| Exact Mass | 221.10500 |
| PSA | 55.40000 |
| LogP | 1.68140 |
| Index of Refraction | 1.515 |
| InChIKey | UAKPKZKOIQYSJW-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNC(=O)CC(C)=O)cc1 |
| HS Code | 2924299090 |
|---|
|
~74%
N-[(4-methoxyph... CAS#:51719-12-1 |
| Literature: Ancizu, Saioa; Moreno, Elsa; Solano, Beatriz; Villar, Raquel; Burguete, Asuncion; Torres, Enrique; Perez-Silanes, Silvia; Aldana, Ignacio; Monge, Antonio Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 7 p. 2713 - 2719 |
|
~%
N-[(4-methoxyph... CAS#:51719-12-1 |
| Literature: Giacomelli, Giampaolo; Porcheddu, Andrea; Salaris, Margherita; Taddei, Maurizio European Journal of Organic Chemistry, 2003 , # 3 p. 537 - 541 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |