1,6-Dimethyl-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid structure
|
Common Name | 1,6-Dimethyl-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 51726-43-3 | Molecular Weight | 217.22100 | |
| Density | 1.327g/cm3 | Boiling Point | 389.9ºC at 760 mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.6ºC | |
| Name | 1,6-dimethyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 389.9ºC at 760 mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22100 |
| Flash Point | 189.6ºC |
| Exact Mass | 217.07400 |
| PSA | 59.30000 |
| LogP | 1.54510 |
| Index of Refraction | 1.618 |
| InChIKey | BRENAYCUDGIHED-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)c(=O)c(C(=O)O)cn2C |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,6-dimethyl-4-oxohydroquinoline-3-carboxylic acid |
| 1,6-dimethyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |