1,2-Bis(4-hydroxyphenyl)ethane-1,2-diol structure
|
Common Name | 1,2-Bis(4-hydroxyphenyl)ethane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 5173-27-3 | Molecular Weight | 246.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-Bis(4-hydroxyphenyl)ethane-1,2-diol |
|---|
| Molecular Formula | C14H14O4 |
|---|---|
| Molecular Weight | 246.25900 |
| Exact Mass | 246.08900 |
| PSA | 80.92000 |
| LogP | 1.86480 |
| InChIKey | GRCDZLQANHNACB-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C(O)C(O)c2ccc(O)cc2)cc1 |
| HS Code | 2907299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |