1-methyl-8-nitro-quinoline structure
|
Common Name | 1-methyl-8-nitro-quinoline | ||
|---|---|---|---|---|
| CAS Number | 51741-75-4 | Molecular Weight | 316.09500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-8-nitroquinolin-1-ium,iodide |
|---|
| Molecular Formula | C10H9IN2O2 |
|---|---|
| Molecular Weight | 316.09500 |
| Exact Mass | 315.97100 |
| PSA | 49.70000 |
| InChIKey | HQWXQELIBOUKBO-UHFFFAOYSA-M |
| SMILES | C[n+]1cccc2cccc([N+](=O)[O-])c21.[I-] |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|