4-[2-(propan-2-ylamino)ethyl]benzene-1,2-diol,hydrochloride structure
|
Common Name | 4-[2-(propan-2-ylamino)ethyl]benzene-1,2-diol,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 5178-52-9 | Molecular Weight | 231.71900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(propan-2-ylamino)ethyl]benzene-1,2-diol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H18ClNO2 |
|---|---|
| Molecular Weight | 231.71900 |
| Exact Mass | 231.10300 |
| PSA | 52.49000 |
| LogP | 2.83120 |
| InChIKey | MRYVSCVPICTKEY-UHFFFAOYSA-N |
| SMILES | CC(C)NCCc1ccc(O)c(O)c1.Cl |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Pyrocatechol,4-(2-(isopropylamino)ethyl)-,hydrochloride |
| 1-(3,4-Dihydroxyphenyl)-2-isopropylaminoethane hydrochloride |
| 1,2-Benzenediol,4-(2-((1-methylethyl)amino)ethyl)-,hydrochloride |
| Desoxyisoprenaline hydrochloride |
| Desoxyisoproterenol hydrochloride |
| Isopropyldopamine hydrochloride |
| 4-(2-(Isopropylamino)ethyl)pyrocatechol hydrochloride |
| WIN 5571 |
| N-Isopropyldopamine hydrochloride |