5-(3-Methoxy-phenyl)-2H-pyrazole-3-carboxylic acid methyl ester
Modify Date: 2025-09-12 18:05:17
5-(3-Methoxy-phenyl)-2H-pyrazole-3-carboxylic acid methyl ester structure
|
Common Name | 5-(3-Methoxy-phenyl)-2H-pyrazole-3-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 517870-26-7 | Molecular Weight | 232.23500 | |
| Density | 1.234g/cm3 | Boiling Point | 444ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.3ºC | |
| Name | methyl 3-(3-methoxyphenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 444ºC at 760 mmHg |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.23500 |
| Flash Point | 222.3ºC |
| Exact Mass | 232.08500 |
| PSA | 64.21000 |
| LogP | 1.87190 |
| Index of Refraction | 1.57 |
| InChIKey | DXLHHWULCGOGII-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(-c2cccc(OC)c2)n[nH]1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| f2130-0126 |