6-methylheptyl 2-(2,4-dichlorophenoxy)acetate,6-methylheptyl 2-(2,4,5-trichlorophenoxy)acetate
Modify Date: 2025-09-24 18:51:44
6-methylheptyl 2-(2,4-dichlorophenoxy)acetate,6-methylheptyl 2-(2,4,5-trichlorophenoxy)acetate structure
|
Common Name | 6-methylheptyl 2-(2,4-dichlorophenoxy)acetate,6-methylheptyl 2-(2,4,5-trichlorophenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 51839-28-2 | Molecular Weight | 700.94500 | |
| Density | N/A | Boiling Point | 421.7ºC at 760 mmHg | |
| Molecular Formula | C32H43Cl5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.9ºC | |
| Name | 6-methylheptyl 2-(2,4-dichlorophenoxy)acetate,6-methylheptyl 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 421.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C32H43Cl5O6 |
| Molecular Weight | 700.94500 |
| Flash Point | 144.9ºC |
| Exact Mass | 698.15000 |
| PSA | 71.06000 |
| LogP | 10.91700 |
| InChIKey | YYSGVGWXJCPNDT-UHFFFAOYSA-N |
| SMILES | CC(C)CCCCCOC(=O)COc1cc(Cl)c(Cl)cc1Cl.CC(C)CCCCCOC(=O)COc1ccc(Cl)cc1Cl |
| Isooctyl (2,4-dichlorophenoxy)acetate mixt. with isooctyl (2,4,5-trichlorophenoxy)acetate |
| Acetic acid,(2,4-dichlorophenoxy)-,isooctyl ester,mixt. with isooctyl (2,4,5-trichlorophenoxy)acetate |
| Esterone 3-3E |
| 2,4-D isooctyl ester mixture with 2,4,5-T isooctyl ester |
| 2,4-D isooctyl ester mixt. with 2,4,5-T isooctyl ester |