1-benzoyl-2,2a,3,5-tetrahydrobenzo[cd]indol-4-one structure
|
Common Name | 1-benzoyl-2,2a,3,5-tetrahydrobenzo[cd]indol-4-one | ||
|---|---|---|---|---|
| CAS Number | 51867-06-2 | Molecular Weight | 277.31700 | |
| Density | 1.291g/cm3 | Boiling Point | 473.9ºC at 760 mmHg | |
| Molecular Formula | C18H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222ºC | |
| Name | 1-benzoyl-2,2a,3,5-tetrahydrobenzo[cd]indol-4-one |
|---|
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 473.9ºC at 760 mmHg |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.31700 |
| Flash Point | 222ºC |
| Exact Mass | 277.11000 |
| PSA | 37.38000 |
| LogP | 3.01090 |
| Index of Refraction | 1.659 |
| InChIKey | XZKCQZDPAWMXSP-UHFFFAOYSA-N |
| SMILES | O=C1Cc2cccc3c2C(C1)CN3C(=O)c1ccccc1 |
|
~86%
1-benzoyl-2,2a,... CAS#:51867-06-2 |
| Literature: Bach; Kornfeld; Jones; Chaney; Dorman; Paschal; Clemens; Smalstig Journal of Medicinal Chemistry, 1980 , vol. 23, # 5 p. 481 - 491 |
|
~%
1-benzoyl-2,2a,... CAS#:51867-06-2 |
| Literature: Leanna; Martinelli; Varie; Kress Tetrahedron Letters, 1989 , vol. 30, # 30 p. 3935 - 3938 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |