2-Oxazoleethanol,4,5-dihydro-4,4-dimethyl-a,a-dipropyl- structure
|
Common Name | 2-Oxazoleethanol,4,5-dihydro-4,4-dimethyl-a,a-dipropyl- | ||
|---|---|---|---|---|
| CAS Number | 51869-20-6 | Molecular Weight | 227.34300 | |
| Density | 0.99g/cm3 | Boiling Point | 306.9ºC at 760mmHg | |
| Molecular Formula | C13H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.4ºC | |
| Name | 4-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]heptan-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 306.9ºC at 760mmHg |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.34300 |
| Flash Point | 139.4ºC |
| Exact Mass | 227.18900 |
| PSA | 41.82000 |
| LogP | 2.35070 |
| Index of Refraction | 1.483 |
| InChIKey | RPICOPJLQFAYPF-UHFFFAOYSA-N |
| SMILES | CCCC(O)(CCC)CC1=NC(C)(C)CO1 |
|
~%
2-Oxazoleethano... CAS#:51869-20-6 |
| Literature: Meyers,A.I. et al. Journal of Organic Chemistry, 1974 , vol. 39, p. 2778 - 2783 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-[(4,4-dimethyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]heptan-4-ol |
| 2-Oxazoleethanol,4,5-dihydro-4,4-dimethyl-a,a-dipropyl |