Benzamide,N-[(3,5-dimethyl-1H-pyrazol-1-yl)iminomethyl]- structure
|
Common Name | Benzamide,N-[(3,5-dimethyl-1H-pyrazol-1-yl)iminomethyl]- | ||
|---|---|---|---|---|
| CAS Number | 51883-88-6 | Molecular Weight | 242.27600 | |
| Density | 1.22g/cm3 | Boiling Point | 434.4ºC at 760mmHg | |
| Molecular Formula | C13H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.5ºC | |
| Name | N-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]benzamide |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 434.4ºC at 760mmHg |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.27600 |
| Flash Point | 216.5ºC |
| Exact Mass | 242.11700 |
| PSA | 70.77000 |
| LogP | 2.20340 |
| Index of Refraction | 1.625 |
| InChIKey | KDTSAMCTLHBETH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n(C(=N)NC(=O)c2ccccc2)n1 |
| HS Code | 2933199090 |
|---|
|
~%
Benzamide,N-[(3... CAS#:51883-88-6 |
| Literature: Scott; Reilly Journal of the American Chemical Society, 1952 , vol. 74, p. 4562,4563, 4564 |
|
~%
Benzamide,N-[(3... CAS#:51883-88-6 |
| Literature: Scott; Reilly Journal of the American Chemical Society, 1952 , vol. 74, p. 4562,4563, 4564 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |