N-[2-(3,4-dimethoxyphenyl)-2-oxo-ethyl]acetamide structure
|
Common Name | N-[2-(3,4-dimethoxyphenyl)-2-oxo-ethyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5190-84-1 | Molecular Weight | 237.25200 | |
| Density | 1.141g/cm3 | Boiling Point | 462ºC at 760 mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.2ºC | |
| Name | N-(2-(3,4-dimethoxyphenyl)-2-oxoethyl)acetamide |
|---|
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 462ºC at 760 mmHg |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25200 |
| Flash Point | 233.2ºC |
| Exact Mass | 237.10000 |
| PSA | 64.63000 |
| LogP | 1.41350 |
| Index of Refraction | 1.513 |
| InChIKey | HGKLABWSRXFZQR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CNC(C)=O)cc1OC |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |