4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-amine structure
|
Common Name | 4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 519056-51-0 | Molecular Weight | 269.22300 | |
| Density | 1.339g/cm3 | Boiling Point | 429.5ºC at 760 mmHg | |
| Molecular Formula | C12H10F3N3O | Melting Point | 191ºC | |
| MSDS | N/A | Flash Point | 213.6ºC | |
| Name | 4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 429.5ºC at 760 mmHg |
| Melting Point | 191ºC |
| Molecular Formula | C12H10F3N3O |
| Molecular Weight | 269.22300 |
| Flash Point | 213.6ºC |
| Exact Mass | 269.07800 |
| PSA | 61.03000 |
| LogP | 3.33440 |
| Index of Refraction | 1.538 |
| InChIKey | RAYWTBJRRQFSID-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)nc(N)n2)cc1 |
|
~82%
4-(4-methoxyphe... CAS#:519056-51-0 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 45, # 2 p. 483 - 487 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-trifluoromethyl-6-(4-methoxyphenyl)-2-aminopyrimidine |
| 4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidine-2-ylamine |