1,3,6-Cycloheptatriene-1-carbonyl chloride, 5,5-dimethyl- (9CI) structure
|
Common Name | 1,3,6-Cycloheptatriene-1-carbonyl chloride, 5,5-dimethyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 51906-40-2 | Molecular Weight | 182.64700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5-dimethylcyclohepta-1,3,6-triene-1-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11ClO |
|---|---|
| Molecular Weight | 182.64700 |
| Exact Mass | 182.05000 |
| PSA | 17.07000 |
| LogP | 2.83040 |
| InChIKey | ISIQTTCAYGEASK-UHFFFAOYSA-N |
| SMILES | CC1(C)C=CC=C(C(=O)Cl)C=C1 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 1,3,6-cycloheptatriene-1-carbonyl chloride,5,5-dimethyl |