2-(N-ethylanilino)ethyl benzoate structure
|
Common Name | 2-(N-ethylanilino)ethyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 51920-03-7 | Molecular Weight | 269.33800 | |
| Density | 1.109g/cm3 | Boiling Point | 401.1ºC at 760 mmHg | |
| Molecular Formula | C17H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.5ºC | |
| Name | 2-(N-ethylanilino)ethyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 401.1ºC at 760 mmHg |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.33800 |
| Flash Point | 141.5ºC |
| Exact Mass | 269.14200 |
| PSA | 29.54000 |
| LogP | 3.36990 |
| Index of Refraction | 1.583 |
| InChIKey | LVRZDVFALRTAHV-UHFFFAOYSA-N |
| SMILES | CCN(CCOC(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2922199090 |
|---|
|
~%
2-(N-ethylanili... CAS#:51920-03-7 |
| Literature: Mladenova, Margarita; Ventelon, Lionel; Blanchard-Desce, Mireille Tetrahedron Letters, 1999 , vol. 40, # 38 p. 6923 - 6926 |
|
~%
2-(N-ethylanili... CAS#:51920-03-7 |
| Literature: Davis; Ross Journal of the Chemical Society, 1950 , p. 3056,3058 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 257-512-4 |
| 2-[ethyl(phenyl)amino]ethyl benzoate |
| 2-(Ethylanilino)ethyl benzoate |