GLDA structure
|
Common Name | GLDA | ||
|---|---|---|---|---|
| CAS Number | 51981-21-6 | Molecular Weight | 351.12900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NNa4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GLDATetrasodium glutamate diacetate is a multi-purpose, clear, liquid chelating agent and preservative booster. Tetrasodium Glutamate Diacetate is made from plant material, readily biodegradable, with high solubility over a wide pH range. Tetrasodium Glutamate Diacetate serves the same function in formulations as EDTA, without the health and environmental concerns. |
| Name | n,n-bis(carboxymethyl)-l-glutamic acid tetrasodium salt |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9NNa4O8 |
|---|---|
| Molecular Weight | 351.12900 |
| Exact Mass | 350.99200 |
| PSA | 163.76000 |
| InChIKey | DLTWOYCDRWJVIM-JEDNCBNOSA-N |
| SMILES | O=C(O)CCC(C(=O)O)N(CC(=O)O)CC(=O)O.[Na+] |
| Glutamic acid diacetic acid,tetrasodium salt |
| TETRASODIUM GLUTAMATE DIACETATE |
| TetrasodiuM N,N-Bis(carboxyMethyl)-L-glutaMate |
| GLDA |
| N,N-Bis(carboxymethyl)-L-glutamic Acid Tetrasodium Salt |