2-Propanamine,N,N'-dithiobis[N-(1-methylethyl)- structure
|
Common Name | 2-Propanamine,N,N'-dithiobis[N-(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 51981-26-1 | Molecular Weight | 264.49400 | |
| Density | 0.977g/cm3 | Boiling Point | 315.6ºC at 760mmHg | |
| Molecular Formula | C12H28N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.6ºC | |
| Name | N-[[di(propan-2-yl)amino]disulfanyl]-N-propan-2-ylpropan-2-amine |
|---|
| Density | 0.977g/cm3 |
|---|---|
| Boiling Point | 315.6ºC at 760mmHg |
| Molecular Formula | C12H28N2S2 |
| Molecular Weight | 264.49400 |
| Flash Point | 144.6ºC |
| Exact Mass | 264.16900 |
| PSA | 57.08000 |
| LogP | 4.43540 |
| Index of Refraction | 1.509 |
| InChIKey | QQNBEFPPTZBSMW-UHFFFAOYSA-N |
| SMILES | CC(C)N(SSN(C(C)C)C(C)C)C(C)C |
|
~76%
2-Propanamine,N... CAS#:51981-26-1 |
| Literature: Ramaraju, Praveen; Gergeres, Danielle; Turos, Edward; Dickey, Sonja; Lim, Daniel V.; Thomas, John; Anderson, Burt Bioorganic and Medicinal Chemistry Letters, 2012 , vol. 22, # 11 p. 3623 - 3631 |
|
~%
2-Propanamine,N... CAS#:51981-26-1 |
| Literature: Danen,W.C.; Newkirk,D.D. Journal of the American Chemical Society, 1976 , vol. 98, p. 516 - 520 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |