p-[[4-[(2-hydroxy-1-naphthyl)azo]phenyl]azo]benzenesulphonic acid, compound with 2,2',2''-nitrilotriethanol (1:1) structure
|
Common Name | p-[[4-[(2-hydroxy-1-naphthyl)azo]phenyl]azo]benzenesulphonic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 51988-21-7 | Molecular Weight | 581.64000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H31N5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,4-[[4-[(2Z)-2-(2-oxonaphthalen-1-ylidene)hydrazinyl]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H31N5O7S |
|---|---|
| Molecular Weight | 581.64000 |
| Exact Mass | 581.19400 |
| PSA | 192.86000 |
| LogP | 4.17990 |
| InChIKey | CIXZWJNXFJJLHF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc(N=Nc2ccc(N=Nc3c(O)ccc4ccccc34)cc2)cc1.OCCN(CCO)CCO |
| einecs 257-582-6 |