4-hydroxy-2-(1-hydroxyethyl)-2,5-dimethylfuran-3-one structure
|
Common Name | 4-hydroxy-2-(1-hydroxyethyl)-2,5-dimethylfuran-3-one | ||
|---|---|---|---|---|
| CAS Number | 51994-11-7 | Molecular Weight | 172.17800 | |
| Density | 1.284g/cm3 | Boiling Point | 293ºC at 760 mmHg | |
| Molecular Formula | C8H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.8ºC | |
| Name | 4-hydroxy-2-(1-hydroxyethyl)-2,5-dimethylfuran-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 293ºC at 760 mmHg |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.17800 |
| Flash Point | 117.8ºC |
| Exact Mass | 172.07400 |
| PSA | 66.76000 |
| LogP | 0.51470 |
| Index of Refraction | 1.53 |
| InChIKey | HEBLFQHRAHRFNP-UHFFFAOYSA-N |
| SMILES | CC1=C(O)C(=O)C(C)(C(C)O)O1 |
| HS Code | 2932190090 |
|---|
|
~%
4-hydroxy-2-(1-... CAS#:51994-11-7 |
| Literature: Lever Brothers Company Patent: US4070381 A1, 1978 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-Hydroxy-2-(1-hydroxyethyl)-2,5-dimethylfuran-3(2H)-one |
| EINECS 257-589-4 |
| 1,4-anhydro-6-deoxy-1,4-dimethylhex-1-en-3-ulose |