Ptaeroxylol
Modify Date: 2025-08-29 17:07:01
Ptaeroxylol structure
|
Common Name | Ptaeroxylol | ||
|---|---|---|---|---|
| CAS Number | 520-13-8 | Molecular Weight | 300.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ptaeroxylol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H12O6 |
|---|---|
| Molecular Weight | 300.26 |
| InChIKey | KESASZWFAYMSJZ-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-c1oc2cc(O)cc(O)c2c(=O)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 520-13-8? |
| A: Chinese name of 520-13-8 is 520-13-8. |
| Q: What is the SMILES notation of Ptaeroxylol? |
| A: SMILES notation of Ptaeroxylol is COc1ccccc1-c1oc2cc(O)cc(O)c2c(=O)c1O. |
| Q: What is the CAS number of Ptaeroxylol? |
| A: CAS number of Ptaeroxylol is 520-13-8. |
| Q: What is the molecular formula of Ptaeroxylol? |
| A: Molecular formula of Ptaeroxylol is C16H12O6. |
| Q: What is the English name of Ptaeroxylol? |
| A: The English name of Ptaeroxylol is Ptaeroxylol. |
| Q: What is the molecular weight of Ptaeroxylol? |
| A: Molecular weight of Ptaeroxylol is 300.26. |
| Q: What is the InChIKey of Ptaeroxylol? |
| A: InChIKey of Ptaeroxylol is KESASZWFAYMSJZ-UHFFFAOYSA-N. |